C17H16N2O3 — CID 101346797
(1R,11R,15S)-13-methyl-1-prop-2-enyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-triene-8,12,14-trione (PubChem CID 101346797) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (1R,11R,15S)-13-methyl-1-prop-2-enyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-triene-8,12,14-trione.
| Compound Name | (1R,11R,15S)-13-methyl-1-prop-2-enyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-triene-8,12,14-trione |
|---|---|
| PubChem CID | 101346797 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1R,11R,15S)-13-methyl-1-prop-2-enyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-triene-8,12,14-trione |
| SMILES | C=CC[C@@]12c3ccccc3C(=O)N1C[C@@H]1C(=O)N(C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C17H16N2O3/c1-3-8-17-12-7-5-4-6-10(12)15(21)19(17)9-11-13(17)16(22)18(2)14(11)20/h3-7,11,13H,1,8-9H2,2H3/t11-,13+,17-/m0/s1 |
| InChIKey | MVAIJQJQRUWPHL-PPHDSNJXSA-N |
| XLogP | 1.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|