C19H19F3N2O6S — CID 101347536
7-O-benzyl 3-O-methyl (3R,6S,7S,8aR)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3,7-dicarboxylate (PubChem CID 101347536) has the molecular formula C19H19F3N2O6S and a molecular weight of 460.43 g/mol. Its IUPAC name is 7-O-benzyl 3-O-methyl (3R,6S,7S,8aR)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3,7-dicarboxylate.
| Compound Name | 7-O-benzyl 3-O-methyl (3R,6S,7S,8aR)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3,7-dicarboxylate |
|---|---|
| PubChem CID | 101347536 |
| Molecular Formula | C19H19F3N2O6S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 7-O-benzyl 3-O-methyl (3R,6S,7S,8aR)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CS[C@@H]2C[C@H](C(=O)OCc3ccccc3)[C@H](NC(=O)C(F)(F)F)C(=O)N21 |
| InChI | InChI=1S/C19H19F3N2O6S/c1-29-17(27)12-9-31-13-7-11(16(26)30-8-10-5-3-2-4-6-10)14(15(25)24(12)13)23-18(28)19(20,21)22/h2-6,11-14H,7-9H2,1H3,(H,23,28)/t11-,12-,13+,14-/m0/s1 |
| InChIKey | FBSWELHLMGFRQT-FQUUOJAGSA-N |
| XLogP | 1.24 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |