About N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide
N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide (PubChem CID 101347648) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide.
Molecular Properties
| Compound Name | N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide |
| PubChem CID | 101347648 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide |
| SMILES | CC/C=C/C(=C/NC(C)=O)CC |
| InChI | InChI=1S/C10H17NO/c1-4-6-7-10(5-2)8-11-9(3)12/h6-8H,4-5H2,1-3H3,(H,11,12)/b7-6+,10-8+ |
| InChIKey | PHAAGKICWSOZDU-LQPGMRSMSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide?
The IUPAC name of N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide (CID 101347648) is N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide.
What is the SMILES notation for N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide?
The canonical SMILES for N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide is CC/C=C/C(=C/NC(C)=O)CC.
What is the InChIKey of N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide?
The InChIKey is PHAAGKICWSOZDU-LQPGMRSMSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-6-7-10(5-2)8-11-9(3)12/h6-8H,4-5H2,1-3H3,(H,11,12)/b7-6+,10-8+.
What are the key properties of N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide?
N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide has a molecular weight of 167.25 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide is sourced from PubChem (CID 101347648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).