C10H17NO — CID 101347648
N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide (PubChem CID 101347648) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide.
| Compound Name | N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 101347648 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-[(1E,3E)-2-ethylhexa-1,3-dienyl]acetamide |
| SMILES | CC/C=C/C(=C/NC(C)=O)CC |
| InChI | InChI=1S/C10H17NO/c1-4-6-7-10(5-2)8-11-9(3)12/h6-8H,4-5H2,1-3H3,(H,11,12)/b7-6+,10-8+ |
| InChIKey | PHAAGKICWSOZDU-LQPGMRSMSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|