C9H15NO — CID 10329468
N-[(1Z,5E)-hepta-1,5-dienyl]acetamide (PubChem CID 10329468) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-[(1Z,5E)-hepta-1,5-dienyl]acetamide.
| Compound Name | N-[(1Z,5E)-hepta-1,5-dienyl]acetamide |
|---|---|
| PubChem CID | 10329468 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-[(1Z,5E)-hepta-1,5-dienyl]acetamide |
| SMILES | C/C=C/CC/C=C\NC(C)=O |
| InChI | InChI=1S/C9H15NO/c1-3-4-5-6-7-8-10-9(2)11/h3-4,7-8H,5-6H2,1-2H3,(H,10,11)/b4-3+,8-7- |
| InChIKey | HUPLVINZYHGDBF-UTUPVWNLSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|