C16H23NO2 — CID 101348126
1-[(3R)-3,7-dimethyloct-1-en-3-yl]-4-nitrobenzene (PubChem CID 101348126) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[(3R)-3,7-dimethyloct-1-en-3-yl]-4-nitrobenzene.
| Compound Name | 1-[(3R)-3,7-dimethyloct-1-en-3-yl]-4-nitrobenzene |
|---|---|
| PubChem CID | 101348126 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[(3R)-3,7-dimethyloct-1-en-3-yl]-4-nitrobenzene |
| SMILES | C=C[C@@](C)(CCCC(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H23NO2/c1-5-16(4,12-6-7-13(2)3)14-8-10-15(11-9-14)17(18)19/h5,8-11,13H,1,6-7,12H2,2-4H3/t16-/m0/s1 |
| InChIKey | KPHGYOPBDOILRO-INIZCTEOSA-N |
| XLogP | 4.86 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|