C26H22O6 — CID 101350231
1-[5-[2,2-bis(3-acetyl-4-hydroxyphenyl)ethenyl]-2-hydroxyphenyl]ethanone (PubChem CID 101350231) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-[5-[2,2-bis(3-acetyl-4-hydroxyphenyl)ethenyl]-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[5-[2,2-bis(3-acetyl-4-hydroxyphenyl)ethenyl]-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 101350231 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1-[5-[2,2-bis(3-acetyl-4-hydroxyphenyl)ethenyl]-2-hydroxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(C=C(c2ccc(O)c(C(C)=O)c2)c2ccc(O)c(C(C)=O)c2)ccc1O |
| InChI | InChI=1S/C26H22O6/c1-14(27)20-10-17(4-7-24(20)30)11-23(18-5-8-25(31)21(12-18)15(2)28)19-6-9-26(32)22(13-19)16(3)29/h4-13,30-32H,1-3H3 |
| InChIKey | IGJLAGNYWIZPMM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|