About [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate
[(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate (PubChem CID 101350280) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate.
Analyze [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate?
The IUPAC name of [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate (CID 101350280) is [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate.
What is the SMILES notation for [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate?
The canonical SMILES for [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate is CC(=O)O[C@@H]1CCC2=C(COCO2)C1=O.
What is the InChIKey of [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate?
The InChIKey is XZLQCMDMMATLHX-SECBINFHSA-N. The full InChI is InChI=1S/C10H12O5/c1-6(11)15-9-3-2-8-7(10(9)12)4-13-5-14-8/h9H,2-5H2,1H3/t9-/m1/s1.
What are the key properties of [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate?
[(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate has a molecular weight of 212.20 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-5-oxo-4,6,7,8-tetrahydro-1,3-benzodioxin-6-yl] acetate is sourced from PubChem (CID 101350280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).