C9H13NO2 — CID 145054795
1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-4-yl acetate (PubChem CID 145054795) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-4-yl acetate.
| Compound Name | 1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-4-yl acetate |
|---|---|
| PubChem CID | 145054795 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-4-yl acetate |
| SMILES | CC(=O)OC1CCC2=C1CNC2 |
| InChI | InChI=1S/C9H13NO2/c1-6(11)12-9-3-2-7-4-10-5-8(7)9/h9-10H,2-5H2,1H3 |
| InChIKey | QZSUVPHJERNZBQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|