C10H14O6 — CID 102286991
[(2R,5R)-5-acetyloxy-6-oxooxan-2-yl]methyl acetate (PubChem CID 102286991) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is [(2R,5R)-5-acetyloxy-6-oxooxan-2-yl]methyl acetate.
| Compound Name | [(2R,5R)-5-acetyloxy-6-oxooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102286991 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | [(2R,5R)-5-acetyloxy-6-oxooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC[C@@H](OC(C)=O)C(=O)O1 |
| InChI | InChI=1S/C10H14O6/c1-6(11)14-5-8-3-4-9(10(13)16-8)15-7(2)12/h8-9H,3-5H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | DGZJQWDUWXDBJX-RKDXNWHRSA-N |
| XLogP | 0.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|