C10H14O7 — CID 139069127
[(2R,3S,4S)-4-acetyloxy-3-hydroxy-3-methyl-5-oxooxolan-2-yl]methyl acetate (PubChem CID 139069127) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is [(2R,3S,4S)-4-acetyloxy-3-hydroxy-3-methyl-5-oxooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-4-acetyloxy-3-hydroxy-3-methyl-5-oxooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139069127 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(2R,3S,4S)-4-acetyloxy-3-hydroxy-3-methyl-5-oxooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(=O)[C@@H](OC(C)=O)[C@@]1(C)O |
| InChI | InChI=1S/C10H14O7/c1-5(11)15-4-7-10(3,14)8(9(13)17-7)16-6(2)12/h7-8,14H,4H2,1-3H3/t7-,8-,10+/m1/s1 |
| InChIKey | PSSLFMGVOJPTIV-MRTMQBJTSA-N |
| XLogP | -0.84 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|