C17H26O11 — CID 142342506
[(5S,7aS)-7-acetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate;acetic acid (PubChem CID 142342506) has the molecular formula C17H26O11 and a molecular weight of 406.38 g/mol. Its IUPAC name is [(5S,7aS)-7-acetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate;acetic acid.
| Compound Name | [(5S,7aS)-7-acetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate;acetic acid |
|---|---|
| PubChem CID | 142342506 |
| Molecular Formula | C17H26O11 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [(5S,7aS)-7-acetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate;acetic acid |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)OC[C@@H]1CC(OC(C)=O)[C@@H]2OC(=O)C(C)C2O1 |
| InChI | InChI=1S/C13H18O7.2C2H4O2/c1-6-11-12(20-13(6)16)10(18-8(3)15)4-9(19-11)5-17-7(2)14;2*1-2(3)4/h6,9-12H,4-5H2,1-3H3;2*1H3,(H,3,4)/t6?,9-,10?,11?,12-;;/m0../s1 |
| InChIKey | KWCRMXNTOIEYHB-MGBJSCAISA-N |
| XLogP | 0.38 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|