C14H14F3N3O3S2 — CID 10135176
1-(5-methylsulfonyl-2-pyridinyl)-5-propan-2-ylsulfanyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde (PubChem CID 10135176) has the molecular formula C14H14F3N3O3S2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-(5-methylsulfonyl-2-pyridinyl)-5-propan-2-ylsulfanyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-(5-methylsulfonyl-2-pyridinyl)-5-propan-2-ylsulfanyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 10135176 |
| Molecular Formula | C14H14F3N3O3S2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 1-(5-methylsulfonyl-2-pyridinyl)-5-propan-2-ylsulfanyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
| SMILES | CC(C)Sc1c(C=O)c(C(F)(F)F)nn1-c1ccc(S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C14H14F3N3O3S2/c1-8(2)24-13-10(7-21)12(14(15,16)17)19-20(13)11-5-4-9(6-18-11)25(3,22)23/h4-8H,1-3H3 |
| InChIKey | BSIACYDLUQYYKZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|