About methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine
methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine (PubChem CID 22226767) has the molecular formula C16H16F3N5O2S
and a molecular weight of 399.40 g/mol. Its IUPAC name is methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine.
Molecular Properties
| Compound Name | methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine |
| PubChem CID | 22226767 |
| Molecular Formula | C16H16F3N5O2S |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine |
| SMILES | CN.CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)nc2-c2ccccc2)nc1 |
| InChI | InChI=1S/C15H11F3N4O2S.CH5N/c1-25(23,24)11-7-8-12(19-9-11)22-13(10-5-3-2-4-6-10)20-14(21-22)15(16,17)18;1-2/h2-9H,1H3;2H2,1H3 |
| InChIKey | VUTKCFFKZRKHNA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
The IUPAC name of methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine (CID 22226767) is methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine.
What is the SMILES notation for methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
The canonical SMILES for methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine is CN.CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)nc2-c2ccccc2)nc1.
What is the InChIKey of methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
The InChIKey is VUTKCFFKZRKHNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N4O2S.CH5N/c1-25(23,24)11-7-8-12(19-9-11)22-13(10-5-3-2-4-6-10)20-14(21-22)15(16,17)18;1-2/h2-9H,1H3;2H2,1H3.
What are the key properties of methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine has a molecular weight of 399.40 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;5-methylsulfonyl-2-[5-phenyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine is sourced from PubChem (CID 22226767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).