C16H11ClF3N3O2S — CID 10135715
2-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-5-methylsulfonylpyridine (PubChem CID 10135715) has the molecular formula C16H11ClF3N3O2S and a molecular weight of 401.80 g/mol. Its IUPAC name is 2-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-5-methylsulfonylpyridine.
| Compound Name | 2-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-5-methylsulfonylpyridine |
|---|---|
| PubChem CID | 10135715 |
| Molecular Formula | C16H11ClF3N3O2S |
| Molecular Weight | 401.80 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-5-methylsulfonylpyridine |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)c(Cl)c2-c2ccccc2)nc1 |
| InChI | InChI=1S/C16H11ClF3N3O2S/c1-26(24,25)11-7-8-12(21-9-11)23-14(10-5-3-2-4-6-10)13(17)15(22-23)16(18,19)20/h2-9H,1H3 |
| InChIKey | IICKIGHIYRLUSO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |