C15H11F3N4O4S — CID 22226714
6-[5-(3-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid (PubChem CID 22226714) has the molecular formula C15H11F3N4O4S and a molecular weight of 400.34 g/mol. Its IUPAC name is 6-[5-(3-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid.
| Compound Name | 6-[5-(3-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 22226714 |
| Molecular Formula | C15H11F3N4O4S |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 6-[5-(3-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid |
| SMILES | COc1cccc(-c2nc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)O)cn2)c1 |
| InChI | InChI=1S/C15H11F3N4O4S/c1-26-10-4-2-3-9(7-10)13-20-14(15(16,17)18)21-22(13)12-6-5-11(8-19-12)27(23,24)25/h2-8H,1H3,(H,23,24,25) |
| InChIKey | DJMTXHPOEGCWQQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|