C14H8Cl2F3N5O4S — CID 22226819
6-[5-(3,5-dichloro-4-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid (PubChem CID 22226819) has the molecular formula C14H8Cl2F3N5O4S and a molecular weight of 470.22 g/mol. Its IUPAC name is 6-[5-(3,5-dichloro-4-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid.
| Compound Name | 6-[5-(3,5-dichloro-4-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid |
|---|---|
| PubChem CID | 22226819 |
| Molecular Formula | C14H8Cl2F3N5O4S |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 468.96 |
| IUPAC Name | 6-[5-(3,5-dichloro-4-methoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid |
| SMILES | COc1c(Cl)cc(-c2nc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)O)nn2)cc1Cl |
| InChI | InChI=1S/C14H8Cl2F3N5O4S/c1-28-11-7(15)4-6(5-8(11)16)12-20-13(14(17,18)19)23-24(12)9-2-3-10(22-21-9)29(25,26)27/h2-5H,1H3,(H,25,26,27) |
| InChIKey | RQFCHJVCVMGQEZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|