C17H15F3N4O6S — CID 22226801
6-[3-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid (PubChem CID 22226801) has the molecular formula C17H15F3N4O6S and a molecular weight of 460.39 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid.
| Compound Name | 6-[3-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 22226801 |
| Molecular Formula | C17H15F3N4O6S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 6-[3-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid |
| SMILES | COc1cc(-c2nc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)O)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C17H15F3N4O6S/c1-28-11-6-9(7-12(29-2)14(11)30-3)15-22-16(17(18,19)20)23-24(15)13-5-4-10(8-21-13)31(25,26)27/h4-8H,1-3H3,(H,25,26,27) |
| InChIKey | UGNRYQJEXCYGHA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|