C15H12F3N5O5S — CID 22226860
6-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid (PubChem CID 22226860) has the molecular formula C15H12F3N5O5S and a molecular weight of 431.35 g/mol. Its IUPAC name is 6-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid.
| Compound Name | 6-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid |
|---|---|
| PubChem CID | 22226860 |
| Molecular Formula | C15H12F3N5O5S |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 6-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridazine-3-sulfonic acid |
| SMILES | COc1ccc(-c2nc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)O)nn2)cc1OC |
| InChI | InChI=1S/C15H12F3N5O5S/c1-27-9-4-3-8(7-10(9)28-2)13-19-14(15(16,17)18)22-23(13)11-5-6-12(21-20-11)29(24,25)26/h3-7H,1-2H3,(H,24,25,26) |
| InChIKey | KHEZQTVOKUWWMO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|