C13H8F3N5O3S — CID 22226800
5-[5-pyridin-4-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-2-sulfonic acid (PubChem CID 22226800) has the molecular formula C13H8F3N5O3S and a molecular weight of 371.30 g/mol. Its IUPAC name is 5-[5-pyridin-4-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-2-sulfonic acid.
| Compound Name | 5-[5-pyridin-4-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 22226800 |
| Molecular Formula | C13H8F3N5O3S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 5-[5-pyridin-4-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-n2nc(C(F)(F)F)nc2-c2ccncc2)cn1 |
| InChI | InChI=1S/C13H8F3N5O3S/c14-13(15,16)12-19-11(8-3-5-17-6-4-8)21(20-12)9-1-2-10(18-7-9)25(22,23)24/h1-7H,(H,22,23,24) |
| InChIKey | RBKIOFHNAHDPRO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|