C15H10ClF3N4O3S — CID 22226750
6-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid (PubChem CID 22226750) has the molecular formula C15H10ClF3N4O3S and a molecular weight of 418.78 g/mol. Its IUPAC name is 6-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid.
| Compound Name | 6-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 22226750 |
| Molecular Formula | C15H10ClF3N4O3S |
| Molecular Weight | 418.78 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 6-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine-3-sulfonic acid |
| SMILES | Cc1cc(-c2nc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)O)cn2)ccc1Cl |
| InChI | InChI=1S/C15H10ClF3N4O3S/c1-8-6-9(2-4-11(8)16)13-21-14(15(17,18)19)22-23(13)12-5-3-10(7-20-12)27(24,25)26/h2-7H,1H3,(H,24,25,26) |
| InChIKey | KDKLNNBUFVPEBN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|