C26H37N3O6 — CID 101351896
diethyl 1-cyclohexyl-2-(cyclohexylamino)-5-(2,5-dioxopyrrolidin-1-yl)pyrrole-3,4-dicarboxylate (PubChem CID 101351896) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is diethyl 1-cyclohexyl-2-(cyclohexylamino)-5-(2,5-dioxopyrrolidin-1-yl)pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 1-cyclohexyl-2-(cyclohexylamino)-5-(2,5-dioxopyrrolidin-1-yl)pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101351896 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | diethyl 1-cyclohexyl-2-(cyclohexylamino)-5-(2,5-dioxopyrrolidin-1-yl)pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c(N2C(=O)CCC2=O)n(C2CCCCC2)c1NC1CCCCC1 |
| InChI | InChI=1S/C26H37N3O6/c1-3-34-25(32)21-22(26(33)35-4-2)24(29-19(30)15-16-20(29)31)28(18-13-9-6-10-14-18)23(21)27-17-11-7-5-8-12-17/h17-18,27H,3-16H2,1-2H3 |
| InChIKey | DERJSAQBSBPFQC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|