C22H29N3O4 — CID 135065265
diethyl 5-(cyclohexylamino)-1-(4-methylphenyl)pyrazole-3,4-dicarboxylate (PubChem CID 135065265) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is diethyl 5-(cyclohexylamino)-1-(4-methylphenyl)pyrazole-3,4-dicarboxylate.
| Compound Name | diethyl 5-(cyclohexylamino)-1-(4-methylphenyl)pyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 135065265 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | diethyl 5-(cyclohexylamino)-1-(4-methylphenyl)pyrazole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)cc2)c(NC2CCCCC2)c1C(=O)OCC |
| InChI | InChI=1S/C22H29N3O4/c1-4-28-21(26)18-19(22(27)29-5-2)24-25(17-13-11-15(3)12-14-17)20(18)23-16-9-7-6-8-10-16/h11-14,16,23H,4-10H2,1-3H3 |
| InChIKey | CVLXFVANNHVPMM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |