C20H36N3O3S+ — CID 101352006
N-[3-(3-butylimidazol-1-ium-1-yl)propyl]-1-[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide (PubChem CID 101352006) has the molecular formula C20H36N3O3S+ and a molecular weight of 398.59 g/mol. Its IUPAC name is N-[3-(3-butylimidazol-1-ium-1-yl)propyl]-1-[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide.
| Compound Name | N-[3-(3-butylimidazol-1-ium-1-yl)propyl]-1-[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
|---|---|
| PubChem CID | 101352006 |
| Molecular Formula | C20H36N3O3S+ |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | N-[3-(3-butylimidazol-1-ium-1-yl)propyl]-1-[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
| SMILES | CCCCn1cc[n+](CCCNS(=O)(=O)C[C@]23CC[C@H](C[C@H]2O)C3(C)C)c1 |
| InChI | InChI=1S/C20H36N3O3S/c1-4-5-10-22-12-13-23(16-22)11-6-9-21-27(25,26)15-20-8-7-17(14-18(20)24)19(20,2)3/h12-13,16-18,21,24H,4-11,14-15H2,1-3H3/q+1/t17-,18-,20-/m1/s1 |
| InChIKey | IUEDMTPIUHGIDJ-QWFCFKBJSA-N |
| XLogP | 2.07 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|