C18H32O7 — CID 101352344
(4R,5R)-5-[(1S,3S,4R)-3-hydroxy-1-methoxy-4-methylhex-5-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one (PubChem CID 101352344) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is (4R,5R)-5-[(1S,3S,4R)-3-hydroxy-1-methoxy-4-methylhex-5-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one.
| Compound Name | (4R,5R)-5-[(1S,3S,4R)-3-hydroxy-1-methoxy-4-methylhex-5-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 101352344 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (4R,5R)-5-[(1S,3S,4R)-3-hydroxy-1-methoxy-4-methylhex-5-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one |
| SMILES | C=C[C@@H](C)[C@@H](O)C[C@H](OC)[C@H]1OC(=O)C(C)(C)[C@H]1OCOCCOC |
| InChI | InChI=1S/C18H32O7/c1-7-12(2)13(19)10-14(22-6)15-16(18(3,4)17(20)25-15)24-11-23-9-8-21-5/h7,12-16,19H,1,8-11H2,2-6H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | MBWBFAZLVVEOLV-CWVYHPPDSA-N |
| XLogP | 1.53 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|