C22H40O6 — CID 134971556
(3R,7S,8S,9S,10R)-11-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,8-dihydroxy-2,3,10-trimethyl-9-propan-2-yloxyundec-1-en-5-one (PubChem CID 134971556) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is (3R,7S,8S,9S,10R)-11-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,8-dihydroxy-2,3,10-trimethyl-9-propan-2-yloxyundec-1-en-5-one.
| Compound Name | (3R,7S,8S,9S,10R)-11-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,8-dihydroxy-2,3,10-trimethyl-9-propan-2-yloxyundec-1-en-5-one |
|---|---|
| PubChem CID | 134971556 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (3R,7S,8S,9S,10R)-11-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,8-dihydroxy-2,3,10-trimethyl-9-propan-2-yloxyundec-1-en-5-one |
| SMILES | C=C(C)[C@H](C)CC(=O)C[C@H](O)[C@H](O)[C@@H](OC(C)C)[C@H](C)C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H40O6/c1-13(2)15(5)9-17(23)11-19(24)20(25)21(27-14(3)4)16(6)10-18-12-26-22(7,8)28-18/h14-16,18-21,24-25H,1,9-12H2,2-8H3/t15-,16-,18-,19+,20+,21+/m1/s1 |
| InChIKey | FHRGEVXZXLBTKD-YBZCJVABSA-N |
| XLogP | 3.24 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|