C19H32O5 — CID 138970580
(3S)-3-[(2S,3R,7R,8S,9S)-7-hydroxy-3,4,4,8-tetramethyl-9-prop-2-enyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methoxypropanal (PubChem CID 138970580) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (3S)-3-[(2S,3R,7R,8S,9S)-7-hydroxy-3,4,4,8-tetramethyl-9-prop-2-enyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methoxypropanal.
| Compound Name | (3S)-3-[(2S,3R,7R,8S,9S)-7-hydroxy-3,4,4,8-tetramethyl-9-prop-2-enyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methoxypropanal |
|---|---|
| PubChem CID | 138970580 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3S)-3-[(2S,3R,7R,8S,9S)-7-hydroxy-3,4,4,8-tetramethyl-9-prop-2-enyl-1,10-dioxaspiro[4.5]decan-2-yl]-3-methoxypropanal |
| SMILES | C=CC[C@@H]1OC2(C[C@@H](O)[C@@H]1C)O[C@H]([C@H](CC=O)OC)[C@H](C)C2(C)C |
| InChI | InChI=1S/C19H32O5/c1-7-8-15-12(2)14(21)11-19(23-15)18(4,5)13(3)17(24-19)16(22-6)9-10-20/h7,10,12-17,21H,1,8-9,11H2,2-6H3/t12-,13-,14+,15-,16-,17-,19?/m0/s1 |
| InChIKey | PSWJQFZGPYJHPB-AMOSUHFWSA-N |
| XLogP | 2.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|