C20H34O5 — CID 102393965
ethyl (2S,3S)-2-[(1S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enyl]-3-hydroxyheptanoate (PubChem CID 102393965) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is ethyl (2S,3S)-2-[(1S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enyl]-3-hydroxyheptanoate.
| Compound Name | ethyl (2S,3S)-2-[(1S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enyl]-3-hydroxyheptanoate |
|---|---|
| PubChem CID | 102393965 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | ethyl (2S,3S)-2-[(1S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enyl]-3-hydroxyheptanoate |
| SMILES | C=C[C@@H]([C@H](C(=O)OCC)[C@@H](O)CCCC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C20H34O5/c1-4-7-11-16(21)18(19(22)23-6-3)15(5-2)17-14-24-20(25-17)12-9-8-10-13-20/h5,15-18,21H,2,4,6-14H2,1,3H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | REJWUMSVGTWBDG-XDNAFOTISA-N |
| XLogP | 3.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|