C16H26O5 — CID 10891859
3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)-1-hydroxyethyl]-4-ethenyl-4-methyloxolan-2-one (PubChem CID 10891859) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)-1-hydroxyethyl]-4-ethenyl-4-methyloxolan-2-one.
| Compound Name | 3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)-1-hydroxyethyl]-4-ethenyl-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 10891859 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)-1-hydroxyethyl]-4-ethenyl-4-methyloxolan-2-one |
| SMILES | C=CC1(C)COC(=O)C1C(O)CC1(C(C)CC)OCCO1 |
| InChI | InChI=1S/C16H26O5/c1-5-11(3)16(20-7-8-21-16)9-12(17)13-14(18)19-10-15(13,4)6-2/h6,11-13,17H,2,5,7-10H2,1,3-4H3 |
| InChIKey | BMUJGQUEJPKKAE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|