C14H22O6 — CID 10541191
(2S)-2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]pent-4-enoic acid (PubChem CID 10541191) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (2S)-2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]pent-4-enoic acid.
| Compound Name | (2S)-2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 10541191 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2S)-2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]pent-4-enoic acid |
| SMILES | C=CC[C@@H](C[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21)C(=O)O |
| InChI | InChI=1S/C14H22O6/c1-5-6-8(12(15)16)7-9-10-11(13(17-4)18-9)20-14(2,3)19-10/h5,8-11,13H,1,6-7H2,2-4H3,(H,15,16)/t8-,9+,10+,11+,13+/m0/s1 |
| InChIKey | ZOTSZPUHXSRMMR-ZZZDWPBISA-N |
| XLogP | 1.54 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|