C13H20O7 — CID 135038626
(5R)-5-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-(hydroxymethyl)oxolan-2-one (PubChem CID 135038626) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is (5R)-5-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-(hydroxymethyl)oxolan-2-one.
| Compound Name | (5R)-5-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 135038626 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (5R)-5-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-(hydroxymethyl)oxolan-2-one |
| SMILES | CO[C@H]1O[C@H]([C@@H]2OC(=O)CC2CO)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C13H20O7/c1-13(2)19-10-9(18-12(16-3)11(10)20-13)8-6(5-14)4-7(15)17-8/h6,8-12,14H,4-5H2,1-3H3/t6?,8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | GCFBHQUWZNWWDG-JZUDMIHDSA-N |
| XLogP | -0.20 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |