C19H28O6 — CID 10784179
(2S,3aS,3'aS,5R,7S,7'S,7aS,7'aS)-2-[(1S)-1-hydroxybut-3-enyl]-7,7'-dimethylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,5'-3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2'-one (PubChem CID 10784179) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2S,3aS,3'aS,5R,7S,7'S,7aS,7'aS)-2-[(1S)-1-hydroxybut-3-enyl]-7,7'-dimethylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,5'-3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2'-one.
| Compound Name | (2S,3aS,3'aS,5R,7S,7'S,7aS,7'aS)-2-[(1S)-1-hydroxybut-3-enyl]-7,7'-dimethylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,5'-3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2'-one |
|---|---|
| PubChem CID | 10784179 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2S,3aS,3'aS,5R,7S,7'S,7aS,7'aS)-2-[(1S)-1-hydroxybut-3-enyl]-7,7'-dimethylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,5'-3a,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran]-2'-one |
| SMILES | C=CC[C@H](O)[C@@H]1C[C@@H]2O[C@]3(C[C@H](C)[C@@H]4OC(=O)C[C@@H]4O3)C[C@H](C)[C@@H]2O1 |
| InChI | InChI=1S/C19H28O6/c1-4-5-12(20)13-6-14-17(22-13)10(2)8-19(24-14)9-11(3)18-15(25-19)7-16(21)23-18/h4,10-15,17-18,20H,1,5-9H2,2-3H3/t10-,11-,12-,13-,14-,15-,17-,18-,19+/m0/s1 |
| InChIKey | JTFKAEDMXOGYEB-VRJGQDFESA-N |
| XLogP | 1.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|