C17H28O6 — CID 10853734
(2R,5S)-2-[2-(2-hydroxyethyl)but-3-enyl]-4,4-dimethoxy-8-methyl-1,10-dioxaspiro[4.5]decan-7-one (PubChem CID 10853734) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2R,5S)-2-[2-(2-hydroxyethyl)but-3-enyl]-4,4-dimethoxy-8-methyl-1,10-dioxaspiro[4.5]decan-7-one.
| Compound Name | (2R,5S)-2-[2-(2-hydroxyethyl)but-3-enyl]-4,4-dimethoxy-8-methyl-1,10-dioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 10853734 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (2R,5S)-2-[2-(2-hydroxyethyl)but-3-enyl]-4,4-dimethoxy-8-methyl-1,10-dioxaspiro[4.5]decan-7-one |
| SMILES | C=CC(CCO)C[C@@H]1CC(OC)(OC)[C@]2(CC(=O)C(C)CO2)O1 |
| InChI | InChI=1S/C17H28O6/c1-5-13(6-7-18)8-14-9-16(20-3,21-4)17(23-14)10-15(19)12(2)11-22-17/h5,12-14,18H,1,6-11H2,2-4H3/t12?,13?,14-,17+/m1/s1 |
| InChIKey | CWDFGVBVSYFIES-GROLMSMHSA-N |
| XLogP | 1.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|