C25H42O7Si — CID 143150612
methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-5-hydroxy-1-trimethylsilylpent-1-en-3-yl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate (PubChem CID 143150612) has the molecular formula C25H42O7Si and a molecular weight of 482.69 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-5-hydroxy-1-trimethylsilylpent-1-en-3-yl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-5-hydroxy-1-trimethylsilylpent-1-en-3-yl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
|---|---|
| PubChem CID | 143150612 |
| Molecular Formula | C25H42O7Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-5-hydroxy-1-trimethylsilylpent-1-en-3-yl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H](C(/C=C/[Si](C)(C)C)CCO)[C@H]3OC4(CCCCC4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C25H42O7Si/c1-28-20(27)16-18-8-9-19-22(29-18)24-23(31-25(32-24)12-6-5-7-13-25)21(30-19)17(10-14-26)11-15-33(2,3)4/h11,15,17-19,21-24,26H,5-10,12-14,16H2,1-4H3/b15-11+/t17?,18-,19+,21+,22+,23-,24+/m1/s1 |
| InChIKey | UODWZWAXTDUNLC-LLRPJSHXSA-N |
| XLogP | 3.74 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|