C17H26O8 — CID 11046553
(2R)-2-[(R)-hydroxy-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-3-methylbut-3-enoic acid (PubChem CID 11046553) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2R)-2-[(R)-hydroxy-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-3-methylbut-3-enoic acid.
| Compound Name | (2R)-2-[(R)-hydroxy-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-3-methylbut-3-enoic acid |
|---|---|
| PubChem CID | 11046553 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (2R)-2-[(R)-hydroxy-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]-3-methylbut-3-enoic acid |
| SMILES | C=C(C)[C@@H](C(=O)O)[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H26O8/c1-7(2)8(14(19)20)9(18)10-11-12(23-16(3,4)22-11)13-15(21-10)25-17(5,6)24-13/h8-13,15,18H,1H2,2-6H3,(H,19,20)/t8-,9-,10-,11+,12+,13-,15-/m1/s1 |
| InChIKey | MTSWDUMMFJNKPT-TVOPQIJMSA-N |
| XLogP | 1.02 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|