C24H36O10 — CID 88971732
ethyl 2-[(3aS,6S,7S,7aR)-6-[2-(2-ethoxy-2-oxoethyl)-2-methyl-1,3-dioxolan-4-yl]-7-hydroxy-2-methyl-5-(2-methylprop-2-enoyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]acetate (PubChem CID 88971732) has the molecular formula C24H36O10 and a molecular weight of 484.54 g/mol. Its IUPAC name is ethyl 2-[(3aS,6S,7S,7aR)-6-[2-(2-ethoxy-2-oxoethyl)-2-methyl-1,3-dioxolan-4-yl]-7-hydroxy-2-methyl-5-(2-methylprop-2-enoyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]acetate.
| Compound Name | ethyl 2-[(3aS,6S,7S,7aR)-6-[2-(2-ethoxy-2-oxoethyl)-2-methyl-1,3-dioxolan-4-yl]-7-hydroxy-2-methyl-5-(2-methylprop-2-enoyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]acetate |
|---|---|
| PubChem CID | 88971732 |
| Molecular Formula | C24H36O10 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | ethyl 2-[(3aS,6S,7S,7aR)-6-[2-(2-ethoxy-2-oxoethyl)-2-methyl-1,3-dioxolan-4-yl]-7-hydroxy-2-methyl-5-(2-methylprop-2-enoyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]acetate |
| SMILES | C=C(C)C(=O)C1O[C@H]2CC(C)(CC(=O)OCC)O[C@@H]2[C@@H](O)[C@H]1C1COC(C)(CC(=O)OCC)O1 |
| InChI | InChI=1S/C24H36O10/c1-7-29-16(25)10-23(5)9-14-21(34-23)20(28)18(22(32-14)19(27)13(3)4)15-12-31-24(6,33-15)11-17(26)30-8-2/h14-15,18,20-22,28H,3,7-12H2,1-2,4-6H3/t14-,15?,18+,20-,21-,22?,23?,24?/m0/s1 |
| InChIKey | GTZAZLKAADCKJG-FDSLRPMTSA-N |
| XLogP | 1.46 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|