C13H22O8 — CID 100993310
ethyl 2-[(2S,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]acetate (PubChem CID 100993310) has the molecular formula C13H22O8 and a molecular weight of 306.31 g/mol. Its IUPAC name is ethyl 2-[(2S,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]acetate |
|---|---|
| PubChem CID | 100993310 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | ethyl 2-[(2S,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(C)OC[C@H]2O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C13H22O8/c1-4-18-8(14)5-13(2)19-6-7-11(21-13)9(15)10(16)12(17-3)20-7/h7,9-12,15-16H,4-6H2,1-3H3/t7-,9-,10-,11-,12+,13+/m1/s1 |
| InChIKey | LBWABYQPXDMWEC-KGEGPYLKSA-N |
| XLogP | -0.84 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |