C22H32O11 — CID 88971725
[(1R,2S,6S,8R)-4,11-bis(2-ethoxy-2-oxoethyl)-4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methyl 2-methylprop-2-enoate (PubChem CID 88971725) has the molecular formula C22H32O11 and a molecular weight of 472.49 g/mol. Its IUPAC name is [(1R,2S,6S,8R)-4,11-bis(2-ethoxy-2-oxoethyl)-4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(1R,2S,6S,8R)-4,11-bis(2-ethoxy-2-oxoethyl)-4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88971725 |
| Molecular Formula | C22H32O11 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [(1R,2S,6S,8R)-4,11-bis(2-ethoxy-2-oxoethyl)-4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@@]12O[C@@H]3COC(C)(CC(=O)OCC)O[C@H]3[C@@H]1OC(C)(CC(=O)OCC)O2 |
| InChI | InChI=1S/C22H32O11/c1-7-26-15(23)9-20(5)29-11-14-17(31-20)18-22(30-14,12-28-19(25)13(3)4)33-21(6,32-18)10-16(24)27-8-2/h14,17-18H,3,7-12H2,1-2,4-6H3/t14-,17-,18+,20?,21?,22+/m1/s1 |
| InChIKey | XLIQROHYQBINJJ-OSFHZDLOSA-N |
| XLogP | 1.37 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|