C16H26O6 — CID 10615169
(3R,4S)-4-ethenyl-3-[(3R,4S)-3-hydroxy-4-methylhexanoyl]-3-(methoxymethoxy)-4-methyloxolan-2-one (PubChem CID 10615169) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (3R,4S)-4-ethenyl-3-[(3R,4S)-3-hydroxy-4-methylhexanoyl]-3-(methoxymethoxy)-4-methyloxolan-2-one.
| Compound Name | (3R,4S)-4-ethenyl-3-[(3R,4S)-3-hydroxy-4-methylhexanoyl]-3-(methoxymethoxy)-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 10615169 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3R,4S)-4-ethenyl-3-[(3R,4S)-3-hydroxy-4-methylhexanoyl]-3-(methoxymethoxy)-4-methyloxolan-2-one |
| SMILES | C=C[C@@]1(C)COC(=O)[C@]1(OCOC)C(=O)C[C@@H](O)[C@@H](C)CC |
| InChI | InChI=1S/C16H26O6/c1-6-11(3)12(17)8-13(18)16(22-10-20-5)14(19)21-9-15(16,4)7-2/h7,11-12,17H,2,6,8-10H2,1,3-5H3/t11-,12+,15-,16+/m0/s1 |
| InChIKey | SCIBXCPDQRMSIW-SHUKQUCYSA-N |
| XLogP | 1.46 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|