C17H26O7 — CID 11046128
(3S,4S)-4-ethenyl-3-(methoxymethoxy)-4-methyl-3-[2-(2-propan-2-yl-1,3-dioxolan-2-yl)acetyl]oxolan-2-one (PubChem CID 11046128) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is (3S,4S)-4-ethenyl-3-(methoxymethoxy)-4-methyl-3-[2-(2-propan-2-yl-1,3-dioxolan-2-yl)acetyl]oxolan-2-one.
| Compound Name | (3S,4S)-4-ethenyl-3-(methoxymethoxy)-4-methyl-3-[2-(2-propan-2-yl-1,3-dioxolan-2-yl)acetyl]oxolan-2-one |
|---|---|
| PubChem CID | 11046128 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3S,4S)-4-ethenyl-3-(methoxymethoxy)-4-methyl-3-[2-(2-propan-2-yl-1,3-dioxolan-2-yl)acetyl]oxolan-2-one |
| SMILES | C=C[C@@]1(C)COC(=O)[C@@]1(OCOC)C(=O)CC1(C(C)C)OCCO1 |
| InChI | InChI=1S/C17H26O7/c1-6-15(4)10-21-14(19)17(15,24-11-20-5)13(18)9-16(12(2)3)22-7-8-23-16/h6,12H,1,7-11H2,2-5H3/t15-,17-/m0/s1 |
| InChIKey | BOKHRGSQANTQHT-RDJZCZTQSA-N |
| XLogP | 1.45 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|