C13H18O6 — CID 10084477
(3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-3-prop-2-enyloxolane-2,4-dione (PubChem CID 10084477) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-3-prop-2-enyloxolane-2,4-dione.
| Compound Name | (3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-3-prop-2-enyloxolane-2,4-dione |
|---|---|
| PubChem CID | 10084477 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-3-prop-2-enyloxolane-2,4-dione |
| SMILES | C=CC[C@]1(OC)C(=O)O[C@H]([C@@H]2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C13H18O6/c1-5-6-13(16-4)10(14)9(18-11(13)15)8-7-17-12(2,3)19-8/h5,8-9H,1,6-7H2,2-4H3/t8-,9+,13+/m0/s1 |
| InChIKey | JAWOUQLGXRRLOD-IGJMFERPSA-N |
| XLogP | 0.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|