C28H46O7 — CID 123946415
[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 3-methyloctadec-9-enoate (PubChem CID 123946415) has the molecular formula C28H46O7 and a molecular weight of 494.67 g/mol. Its IUPAC name is [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 3-methyloctadec-9-enoate.
| Compound Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 3-methyloctadec-9-enoate |
|---|---|
| PubChem CID | 123946415 |
| Molecular Formula | C28H46O7 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 3-methyloctadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCC(C)CC(=O)OC1C(=O)OC(C2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C28H46O7/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(2)19-23(29)33-26-24(30)25(34-27(26)31)22-20-32-28(3,4)35-22/h12-13,21-22,25-26H,5-11,14-20H2,1-4H3 |
| InChIKey | BJEOFZFKGDBHMK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|