C23H38O7 — CID 101252400
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (Z,2R)-2-methyldec-3-enoate (PubChem CID 101252400) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (Z,2R)-2-methyldec-3-enoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (Z,2R)-2-methyldec-3-enoate |
|---|---|
| PubChem CID | 101252400 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (Z,2R)-2-methyldec-3-enoate |
| SMILES | CCCCCC/C=C\[C@@H](C)C(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H38O7/c1-7-8-9-10-11-12-13-15(2)20(24)26-18-17(16-14-25-22(3,4)28-16)27-21-19(18)29-23(5,6)30-21/h12-13,15-19,21H,7-11,14H2,1-6H3/b13-12-/t15-,16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | OUGZJBUIYBENHC-GACUTDAGSA-N |
| XLogP | 4.09 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|