C17H28O7 — CID 10969984
(4S)-4-ethenyl-3-[1-hydroxy-2-(2-propan-2-yl-1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-4-methyloxolan-2-one (PubChem CID 10969984) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is (4S)-4-ethenyl-3-[1-hydroxy-2-(2-propan-2-yl-1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-4-methyloxolan-2-one.
| Compound Name | (4S)-4-ethenyl-3-[1-hydroxy-2-(2-propan-2-yl-1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 10969984 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (4S)-4-ethenyl-3-[1-hydroxy-2-(2-propan-2-yl-1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-4-methyloxolan-2-one |
| SMILES | C=C[C@@]1(C)COC(=O)C1(OCOC)C(O)CC1(C(C)C)OCCO1 |
| InChI | InChI=1S/C17H28O7/c1-6-15(4)10-21-14(19)17(15,24-11-20-5)13(18)9-16(12(2)3)22-7-8-23-16/h6,12-13,18H,1,7-11H2,2-5H3/t13?,15-,17?/m0/s1 |
| InChIKey | UBPXKCKZHZNCQQ-GULBITTBSA-N |
| XLogP | 1.24 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|