C20H34O6 — CID 11057729
(2S,3S,4S,5R,8S)-8-decyl-4-ethenyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one (PubChem CID 11057729) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2S,3S,4S,5R,8S)-8-decyl-4-ethenyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one.
| Compound Name | (2S,3S,4S,5R,8S)-8-decyl-4-ethenyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 11057729 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (2S,3S,4S,5R,8S)-8-decyl-4-ethenyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one |
| SMILES | C=C[C@]1(O)[C@H](O)[C@@H](OC)O[C@]12C[C@H](CCCCCCCCCC)OC2=O |
| InChI | InChI=1S/C20H34O6/c1-4-6-7-8-9-10-11-12-13-15-14-20(18(22)25-15)19(23,5-2)16(21)17(24-3)26-20/h5,15-17,21,23H,2,4,6-14H2,1,3H3/t15-,16+,17-,19-,20-/m0/s1 |
| InChIKey | YJVDXDXCHDBXPR-VYMYIBDJSA-N |
| XLogP | 2.85 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|