C29H48O6 — CID 23583713
tert-butyl (2R,3S)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-3-ethenyl-5-hydroxy-2-prop-2-enyloxolane-2-carboxylate (PubChem CID 23583713) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is tert-butyl (2R,3S)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-3-ethenyl-5-hydroxy-2-prop-2-enyloxolane-2-carboxylate.
| Compound Name | tert-butyl (2R,3S)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-3-ethenyl-5-hydroxy-2-prop-2-enyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 23583713 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | tert-butyl (2R,3S)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-3-ethenyl-5-hydroxy-2-prop-2-enyloxolane-2-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OC(C)(C)C)OC(O)(C(=C)C(CCCCCCCCC)C2OCCO2)C[C@H]1C=C |
| InChI | InChI=1S/C29H48O6/c1-8-11-12-13-14-15-16-17-24(25-32-19-20-33-25)22(4)29(31)21-23(10-3)28(35-29,18-9-2)26(30)34-27(5,6)7/h9-10,23-25,31H,2-4,8,11-21H2,1,5-7H3/t23-,24?,28-,29?/m1/s1 |
| InChIKey | PBDRDSDYPSUPAR-YACIKWFMSA-N |
| XLogP | 6.24 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|