C29H46O6 — CID 23583714
tert-butyl (2R,3S)-7-acetyloxy-3-ethenyl-9-methylidene-8-nonyl-2-prop-2-enyl-1,6-dioxaspiro[4.4]nonane-2-carboxylate (PubChem CID 23583714) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is tert-butyl (2R,3S)-7-acetyloxy-3-ethenyl-9-methylidene-8-nonyl-2-prop-2-enyl-1,6-dioxaspiro[4.4]nonane-2-carboxylate.
| Compound Name | tert-butyl (2R,3S)-7-acetyloxy-3-ethenyl-9-methylidene-8-nonyl-2-prop-2-enyl-1,6-dioxaspiro[4.4]nonane-2-carboxylate |
|---|---|
| PubChem CID | 23583714 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | tert-butyl (2R,3S)-7-acetyloxy-3-ethenyl-9-methylidene-8-nonyl-2-prop-2-enyl-1,6-dioxaspiro[4.4]nonane-2-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OC(C)(C)C)OC2(C[C@H]1C=C)OC(OC(C)=O)C(CCCCCCCCC)C2=C |
| InChI | InChI=1S/C29H46O6/c1-9-12-13-14-15-16-17-18-24-21(4)29(33-25(24)32-22(5)30)20-23(11-3)28(35-29,19-10-2)26(31)34-27(6,7)8/h10-11,23-25H,2-4,9,12-20H2,1,5-8H3/t23-,24?,25?,28-,29?/m1/s1 |
| InChIKey | UCCUVASQQVXVPJ-SQLRZCDXSA-N |
| XLogP | 6.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|