C35H60O10 — CID 11227497
ditert-butyl (2R,3R)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-5-hydroxy-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]oxolane-2,3-dicarboxylate (PubChem CID 11227497) has the molecular formula C35H60O10 and a molecular weight of 640.86 g/mol. Its IUPAC name is ditert-butyl (2R,3R)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-5-hydroxy-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]oxolane-2,3-dicarboxylate.
| Compound Name | ditert-butyl (2R,3R)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-5-hydroxy-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]oxolane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11227497 |
| Molecular Formula | C35H60O10 |
| Molecular Weight | 640.86 g/mol |
| Exact Mass | 640.42 |
| IUPAC Name | ditert-butyl (2R,3R)-5-[3-(1,3-dioxolan-2-yl)dodec-1-en-2-yl]-5-hydroxy-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]oxolane-2,3-dicarboxylate |
| SMILES | C=C(C(CCCCCCCCC)C1OCCO1)C1(O)C[C@@H](C(=O)OC(C)(C)C)[C@](CC(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C35H60O10/c1-12-13-14-15-16-17-18-19-25(29-40-20-21-41-29)24(2)35(39)22-26(28(37)43-32(6,7)8)34(45-35,30(38)44-33(9,10)11)23-27(36)42-31(3,4)5/h25-26,29,39H,2,12-23H2,1,3-11H3/t25?,26-,34+,35?/m0/s1 |
| InChIKey | ITTPNRZQBOMJEA-YODVHNDKSA-N |
| XLogP | 6.55 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.86 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|