C18H32O6 — CID 11110710
(2S,3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one (PubChem CID 11110710) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2S,3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one.
| Compound Name | (2S,3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 11110710 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (2S,3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2-methoxy-1,7-dioxaspiro[4.4]nonan-6-one |
| SMILES | CCCCCCCCCC[C@H]1C[C@]2(O[C@H](OC)[C@@H](O)[C@@H]2O)C(=O)O1 |
| InChI | InChI=1S/C18H32O6/c1-3-4-5-6-7-8-9-10-11-13-12-18(17(21)23-13)15(20)14(19)16(22-2)24-18/h13-16,19-20H,3-12H2,1-2H3/t13-,14-,15-,16-,18+/m0/s1 |
| InChIKey | XJHJUQMPILIMLX-IQWQSGHPSA-N |
| XLogP | 2.30 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|