C16H24O6 — CID 11077834
(3S,4S)-3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)acetyl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-one (PubChem CID 11077834) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3S,4S)-3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)acetyl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-one.
| Compound Name | (3S,4S)-3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)acetyl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 11077834 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3S,4S)-3-[2-(2-butan-2-yl-1,3-dioxolan-2-yl)acetyl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-one |
| SMILES | C=C[C@@]1(C)COC(=O)[C@@]1(O)C(=O)CC1(C(C)CC)OCCO1 |
| InChI | InChI=1S/C16H24O6/c1-5-11(3)15(21-7-8-22-15)9-12(17)16(19)13(18)20-10-14(16,4)6-2/h6,11,19H,2,5,7-10H2,1,3-4H3/t11?,14-,16-/m0/s1 |
| InChIKey | NQDDXGCMZVSNAO-VYIWWYPRSA-N |
| XLogP | 1.22 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|