C21H38O8 — CID 101352346
(4R,5R)-5-[(1S,3S,4S,5R,6R)-3,5-dihydroxy-1-methoxy-4,6-dimethyloct-7-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one (PubChem CID 101352346) has the molecular formula C21H38O8 and a molecular weight of 418.53 g/mol. Its IUPAC name is (4R,5R)-5-[(1S,3S,4S,5R,6R)-3,5-dihydroxy-1-methoxy-4,6-dimethyloct-7-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one.
| Compound Name | (4R,5R)-5-[(1S,3S,4S,5R,6R)-3,5-dihydroxy-1-methoxy-4,6-dimethyloct-7-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 101352346 |
| Molecular Formula | C21H38O8 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (4R,5R)-5-[(1S,3S,4S,5R,6R)-3,5-dihydroxy-1-methoxy-4,6-dimethyloct-7-enyl]-4-(2-methoxyethoxymethoxy)-3,3-dimethyloxolan-2-one |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@@H](C)[C@@H](O)C[C@H](OC)[C@H]1OC(=O)C(C)(C)[C@H]1OCOCCOC |
| InChI | InChI=1S/C21H38O8/c1-8-13(2)17(23)14(3)15(22)11-16(26-7)18-19(21(4,5)20(24)29-18)28-12-27-10-9-25-6/h8,13-19,22-23H,1,9-12H2,2-7H3/t13-,14+,15+,16+,17-,18-,19+/m1/s1 |
| InChIKey | KETMXOZOMVXVEM-LTNFWDJDSA-N |
| XLogP | 1.53 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|